C22H13ClN2O6 — CID 4560277
N-(5-chloro-9,10-dioxoanthracen-1-yl)-2-(2-nitrophenoxy)acetamide (PubChem CID 4560277) has the molecular formula C22H13ClN2O6 and a molecular weight of 436.81 g/mol. Its IUPAC name is N-(5-chloro-9,10-dioxoanthracen-1-yl)-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-(5-chloro-9,10-dioxoanthracen-1-yl)-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 4560277 |
| Molecular Formula | C22H13ClN2O6 |
| Molecular Weight | 436.81 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-(5-chloro-9,10-dioxoanthracen-1-yl)-2-(2-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])Nc1cccc2c1C(=O)c1cccc(Cl)c1C2=O |
| InChI | InChI=1S/C22H13ClN2O6/c23-14-7-3-5-12-19(14)21(27)13-6-4-8-15(20(13)22(12)28)24-18(26)11-31-17-10-2-1-9-16(17)25(29)30/h1-10H,11H2,(H,24,26) |
| InChIKey | IVQGMKRCPNABOU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.81 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|