C16H21N5O3S — CID 4563135
1-(2-morpholin-4-ylethyl)-3-[3-(2-nitrophenyl)prop-2-enylideneamino]thiourea (PubChem CID 4563135) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-[3-(2-nitrophenyl)prop-2-enylideneamino]thiourea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-[3-(2-nitrophenyl)prop-2-enylideneamino]thiourea |
|---|---|
| PubChem CID | 4563135 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-[3-(2-nitrophenyl)prop-2-enylideneamino]thiourea |
| SMILES | O=[N+]([O-])c1ccccc1C=CC=NNC(=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C16H21N5O3S/c22-21(23)15-6-2-1-4-14(15)5-3-7-18-19-16(25)17-8-9-20-10-12-24-13-11-20/h1-7H,8-13H2,(H2,17,19,25) |
| InChIKey | UVQHMBCAHRUZBR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|