C22H30N2O4S — CID 4565333
2,6-ditert-butyl-4-[(4-ethoxy-2-nitrophenyl)sulfanylamino]phenol (PubChem CID 4565333) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(4-ethoxy-2-nitrophenyl)sulfanylamino]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(4-ethoxy-2-nitrophenyl)sulfanylamino]phenol |
|---|---|
| PubChem CID | 4565333 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2,6-ditert-butyl-4-[(4-ethoxy-2-nitrophenyl)sulfanylamino]phenol |
| SMILES | CCOc1ccc(SNc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H30N2O4S/c1-8-28-15-9-10-19(18(13-15)24(26)27)29-23-14-11-16(21(2,3)4)20(25)17(12-14)22(5,6)7/h9-13,23,25H,8H2,1-7H3 |
| InChIKey | JPNULEOXUKHEHR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|