C31H31FN4O5 — CID 4572338
[5-[[(3-fluorophenyl)methyl-[(4-methoxyphenyl)methyl]amino]methyl]furan-2-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 4572338) has the molecular formula C31H31FN4O5 and a molecular weight of 558.61 g/mol. Its IUPAC name is [5-[[(3-fluorophenyl)methyl-[(4-methoxyphenyl)methyl]amino]methyl]furan-2-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [5-[[(3-fluorophenyl)methyl-[(4-methoxyphenyl)methyl]amino]methyl]furan-2-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4572338 |
| Molecular Formula | C31H31FN4O5 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | [5-[[(3-fluorophenyl)methyl-[(4-methoxyphenyl)methyl]amino]methyl]furan-2-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(CN(Cc2cccc(F)c2)Cc2ccc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)o2)cc1 |
| InChI | InChI=1S/C31H31FN4O5/c1-40-28-11-5-23(6-12-28)20-33(21-24-3-2-4-25(32)19-24)22-29-13-14-30(41-29)31(37)35-17-15-34(16-18-35)26-7-9-27(10-8-26)36(38)39/h2-14,19H,15-18,20-22H2,1H3 |
| InChIKey | SLKNUEQDUJZCQE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|