C24H24FN3O4 — CID 4030904
[5-[[(3-fluorophenyl)methyl-[(3-nitrophenyl)methyl]amino]methyl]furan-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 4030904) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is [5-[[(3-fluorophenyl)methyl-[(3-nitrophenyl)methyl]amino]methyl]furan-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-[[(3-fluorophenyl)methyl-[(3-nitrophenyl)methyl]amino]methyl]furan-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 4030904 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | [5-[[(3-fluorophenyl)methyl-[(3-nitrophenyl)methyl]amino]methyl]furan-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc(CN(Cc2cccc(F)c2)Cc2cccc([N+](=O)[O-])c2)o1)N1CCCC1 |
| InChI | InChI=1S/C24H24FN3O4/c25-20-7-3-5-18(13-20)15-26(16-19-6-4-8-21(14-19)28(30)31)17-22-9-10-23(32-22)24(29)27-11-1-2-12-27/h3-10,13-14H,1-2,11-12,15-17H2 |
| InChIKey | RUEMZTRRTZOJSO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|