C21H25N3O8S2 — CID 4574211
[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 4574211) has the molecular formula C21H25N3O8S2 and a molecular weight of 511.58 g/mol. Its IUPAC name is [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 4574211 |
| Molecular Formula | C21H25N3O8S2 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)OCC(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C21H25N3O8S2/c1-16-5-7-18(8-6-16)33(27,28)22-14-21(26)32-15-20(25)23-17-3-2-4-19(13-17)34(29,30)24-9-11-31-12-10-24/h2-8,13,22H,9-12,14-15H2,1H3,(H,23,25) |
| InChIKey | DUVGFQDBIGHSAX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |