C22H23FN2O6S — CID 6107805
[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 6107805) has the molecular formula C22H23FN2O6S and a molecular weight of 462.50 g/mol. Its IUPAC name is [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6107805 |
| Molecular Formula | C22H23FN2O6S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)COC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN2O6S/c1-16-2-8-19(32(28,29)25-10-12-30-13-11-25)14-20(16)24-21(26)15-31-22(27)9-5-17-3-6-18(23)7-4-17/h2-9,14H,10-13,15H2,1H3,(H,24,26)/b9-5+ |
| InChIKey | QJPGCGCXSBWDBA-WEVVVXLNSA-N |
| XLogP | 2.35 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|