About 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone
1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone (PubChem CID 4575525) has the molecular formula C22H21NOS2
and a molecular weight of 379.55 g/mol. Its IUPAC name is 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone.
Molecular Properties
| Compound Name | 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone |
| PubChem CID | 4575525 |
| Molecular Formula | C22H21NOS2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone |
| SMILES | Cc1ccc(C2SCCN2C(=O)C(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C22H21NOS2/c1-16-12-13-19(26-16)22-23(14-15-25-22)21(24)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-13,20,22H,14-15H2,1H3 |
| InChIKey | DSFYOIZHZTXHKL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone?
The IUPAC name of 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone (CID 4575525) is 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone.
What is the SMILES notation for 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone?
The canonical SMILES for 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone is Cc1ccc(C2SCCN2C(=O)C(c2ccccc2)c2ccccc2)s1.
What is the InChIKey of 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone?
The InChIKey is DSFYOIZHZTXHKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NOS2/c1-16-12-13-19(26-16)22-23(14-15-25-22)21(24)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-13,20,22H,14-15H2,1H3.
What are the key properties of 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone?
1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone has a molecular weight of 379.55 g/mol, XLogP of 5.46, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2,2-diphenylethanone is sourced from PubChem (CID 4575525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).