C16H16ClNOS2 — CID 7225825
(2R)-2-chloro-1-[(2R)-2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2-phenylethanone (PubChem CID 7225825) has the molecular formula C16H16ClNOS2 and a molecular weight of 337.90 g/mol. Its IUPAC name is (2R)-2-chloro-1-[(2R)-2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2-phenylethanone.
| Compound Name | (2R)-2-chloro-1-[(2R)-2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 7225825 |
| Molecular Formula | C16H16ClNOS2 |
| Molecular Weight | 337.90 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | (2R)-2-chloro-1-[(2R)-2-(5-methylthiophen-2-yl)-1,3-thiazolidin-3-yl]-2-phenylethanone |
| SMILES | Cc1ccc([C@H]2SCCN2C(=O)[C@H](Cl)c2ccccc2)s1 |
| InChI | InChI=1S/C16H16ClNOS2/c1-11-7-8-13(21-11)16-18(9-10-20-16)15(19)14(17)12-5-3-2-4-6-12/h2-8,14,16H,9-10H2,1H3/t14-,16-/m1/s1 |
| InChIKey | RWPPXAWAWFBYOK-GDBMZVCRSA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.90 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|