C19H20ClNOS — CID 816020
(2R)-2-chloro-1-[(2R)-2-(2,4-dimethylphenyl)-1,3-thiazolidin-3-yl]-2-phenylethanone (PubChem CID 816020) has the molecular formula C19H20ClNOS and a molecular weight of 345.90 g/mol. Its IUPAC name is (2R)-2-chloro-1-[(2R)-2-(2,4-dimethylphenyl)-1,3-thiazolidin-3-yl]-2-phenylethanone.
| Compound Name | (2R)-2-chloro-1-[(2R)-2-(2,4-dimethylphenyl)-1,3-thiazolidin-3-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 816020 |
| Molecular Formula | C19H20ClNOS |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (2R)-2-chloro-1-[(2R)-2-(2,4-dimethylphenyl)-1,3-thiazolidin-3-yl]-2-phenylethanone |
| SMILES | Cc1ccc([C@H]2SCCN2C(=O)[C@H](Cl)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H20ClNOS/c1-13-8-9-16(14(2)12-13)19-21(10-11-23-19)18(22)17(20)15-6-4-3-5-7-15/h3-9,12,17,19H,10-11H2,1-2H3/t17-,19-/m1/s1 |
| InChIKey | AFMBXOKXLWAQDI-IEBWSBKVSA-N |
| XLogP | 4.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|