C13H15Cl2NOS — CID 815956
2,2-dichloro-1-[(2R)-2-(2,4-dimethylphenyl)-1,3-thiazolidin-3-yl]ethanone (PubChem CID 815956) has the molecular formula C13H15Cl2NOS and a molecular weight of 304.24 g/mol. Its IUPAC name is 2,2-dichloro-1-[(2R)-2-(2,4-dimethylphenyl)-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[(2R)-2-(2,4-dimethylphenyl)-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 815956 |
| Molecular Formula | C13H15Cl2NOS |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2,2-dichloro-1-[(2R)-2-(2,4-dimethylphenyl)-1,3-thiazolidin-3-yl]ethanone |
| SMILES | Cc1ccc([C@H]2SCCN2C(=O)C(Cl)Cl)c(C)c1 |
| InChI | InChI=1S/C13H15Cl2NOS/c1-8-3-4-10(9(2)7-8)13-16(5-6-18-13)12(17)11(14)15/h3-4,7,11,13H,5-6H2,1-2H3/t13-/m1/s1 |
| InChIKey | ZTOGOUONCWMSNO-CYBMUJFWSA-N |
| XLogP | 3.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|