C23H17Cl3N2O4 — CID 4579494
2-cyano-3-[3,5-dichloro-2-[2-(4-chlorophenoxy)ethoxy]phenyl]-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 4579494) has the molecular formula C23H17Cl3N2O4 and a molecular weight of 491.76 g/mol. Its IUPAC name is 2-cyano-3-[3,5-dichloro-2-[2-(4-chlorophenoxy)ethoxy]phenyl]-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3,5-dichloro-2-[2-(4-chlorophenoxy)ethoxy]phenyl]-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 4579494 |
| Molecular Formula | C23H17Cl3N2O4 |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | 2-cyano-3-[3,5-dichloro-2-[2-(4-chlorophenoxy)ethoxy]phenyl]-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | N#CC(=Cc1cc(Cl)cc(Cl)c1OCCOc1ccc(Cl)cc1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C23H17Cl3N2O4/c24-17-3-5-19(6-4-17)31-8-9-32-22-15(11-18(25)12-21(22)26)10-16(13-27)23(29)28-14-20-2-1-7-30-20/h1-7,10-12H,8-9,14H2,(H,28,29) |
| InChIKey | WHIUPCAJWMXUIW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|