C17H20ClN3OS — CID 4580976
4-chloro-N-[2-(2,4-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]butanamide (PubChem CID 4580976) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is 4-chloro-N-[2-(2,4-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]butanamide.
| Compound Name | 4-chloro-N-[2-(2,4-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]butanamide |
|---|---|
| PubChem CID | 4580976 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 4-chloro-N-[2-(2,4-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]butanamide |
| SMILES | Cc1ccc(-n2nc3c(c2NC(=O)CCCCl)CSC3)c(C)c1 |
| InChI | InChI=1S/C17H20ClN3OS/c1-11-5-6-15(12(2)8-11)21-17(19-16(22)4-3-7-18)13-9-23-10-14(13)20-21/h5-6,8H,3-4,7,9-10H2,1-2H3,(H,19,22) |
| InChIKey | PDAMULLNVJLSNH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|