C22H28N4O2S — CID 7685420
N'-[2-(2,4-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[(1R,2R)-2-methylcyclohexyl]oxamide (PubChem CID 7685420) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is N'-[2-(2,4-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[(1R,2R)-2-methylcyclohexyl]oxamide.
| Compound Name | N'-[2-(2,4-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[(1R,2R)-2-methylcyclohexyl]oxamide |
|---|---|
| PubChem CID | 7685420 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N'-[2-(2,4-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-[(1R,2R)-2-methylcyclohexyl]oxamide |
| SMILES | Cc1ccc(-n2nc3c(c2NC(=O)C(=O)N[C@@H]2CCCC[C@H]2C)CSC3)c(C)c1 |
| InChI | InChI=1S/C22H28N4O2S/c1-13-8-9-19(15(3)10-13)26-20(16-11-29-12-18(16)25-26)24-22(28)21(27)23-17-7-5-4-6-14(17)2/h8-10,14,17H,4-7,11-12H2,1-3H3,(H,23,27)(H,24,28)/t14-,17-/m1/s1 |
| InChIKey | VWLOPRRECXLOPG-RHSMWYFYSA-N |
| XLogP | 3.87 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|