C6H12N4 — CID 4581755
2-(1-cyclopropylethylideneamino)guanidine (PubChem CID 4581755) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-(1-cyclopropylethylideneamino)guanidine.
| Compound Name | 2-(1-cyclopropylethylideneamino)guanidine |
|---|---|
| PubChem CID | 4581755 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 2-(1-cyclopropylethylideneamino)guanidine |
| SMILES | CC(=NN=C(N)N)C1CC1 |
| InChI | InChI=1S/C6H12N4/c1-4(5-2-3-5)9-10-6(7)8/h5H,2-3H2,1H3,(H4,7,8,10) |
| InChIKey | WUARTDBPJHBRKZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|