C10H14N2S — CID 4584055
N-prop-2-enyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 4584055) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is N-prop-2-enyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | N-prop-2-enyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 4584055 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | N-prop-2-enyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | C=CCNc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C10H14N2S/c1-2-7-11-10-12-8-5-3-4-6-9(8)13-10/h2H,1,3-7H2,(H,11,12) |
| InChIKey | KDHVJBSMFAZRHD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|