C7H8N2OS — CID 64991335
N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)formamide (PubChem CID 64991335) has the molecular formula C7H8N2OS and a molecular weight of 168.22 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)formamide.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)formamide |
|---|---|
| PubChem CID | 64991335 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)formamide |
| SMILES | O=CNc1nc2c(s1)CCC2 |
| InChI | InChI=1S/C7H8N2OS/c10-4-8-7-9-5-2-1-3-6(5)11-7/h4H,1-3H2,(H,8,9,10) |
| InChIKey | DDMZAEVYQHZSQK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|