C14H21NOS — CID 63518040
4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazole-2-carbaldehyde (PubChem CID 63518040) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazole-2-carbaldehyde.
| Compound Name | 4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 63518040 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[d][1,3]thiazole-2-carbaldehyde |
| SMILES | O=Cc1nc2c(s1)CCCCCCCCCC2 |
| InChI | InChI=1S/C14H21NOS/c16-11-14-15-12-9-7-5-3-1-2-4-6-8-10-13(12)17-14/h11H,1-10H2 |
| InChIKey | NJGPUWJYOFDFJO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|