C8H13IN2S — CID 11659373
5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine;hydroiodide (PubChem CID 11659373) has the molecular formula C8H13IN2S and a molecular weight of 296.18 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine;hydroiodide.
| Compound Name | 5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 11659373 |
| Molecular Formula | C8H13IN2S |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine;hydroiodide |
| SMILES | I.Nc1nc2c(s1)CCCCC2 |
| InChI | InChI=1S/C8H12N2S.HI/c9-8-10-6-4-2-1-3-5-7(6)11-8;/h1-5H2,(H2,9,10);1H |
| InChIKey | XNGUDUZJUSPICK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|