C6H8BN3S — CID 88582272
CID 88582272 (PubChem CID 88582272) has the molecular formula C6H8BN3S and a molecular weight of 165.03 g/mol.
| Compound Name | CID 88582272 |
|---|---|
| PubChem CID | 88582272 |
| Molecular Formula | C6H8BN3S |
| Molecular Weight | 165.03 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | — |
| SMILES | [B]N1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C6H8BN3S/c7-10-2-1-4-5(3-10)11-6(8)9-4/h1-3H2,(H2,8,9) |
| InChIKey | QQYDZSJOBWINLT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.03 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|