C13H20N2S — CID 61337841
cyclopropyl(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)methanamine (PubChem CID 61337841) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is cyclopropyl(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)methanamine.
| Compound Name | cyclopropyl(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 61337841 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | cyclopropyl(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)methanamine |
| SMILES | NC(c1nc2c(s1)CCCCCC2)C1CC1 |
| InChI | InChI=1S/C13H20N2S/c14-12(9-7-8-9)13-15-10-5-3-1-2-4-6-11(10)16-13/h9,12H,1-8,14H2 |
| InChIKey | DKEBHXSCDCSGRA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |