C10H14N2S2 — CID 143290602
N-ethenyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methanimine;sulfane (PubChem CID 143290602) has the molecular formula C10H14N2S2 and a molecular weight of 226.37 g/mol. Its IUPAC name is N-ethenyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methanimine;sulfane.
| Compound Name | N-ethenyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methanimine;sulfane |
|---|---|
| PubChem CID | 143290602 |
| Molecular Formula | C10H14N2S2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | N-ethenyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methanimine;sulfane |
| SMILES | C=C/N=C/c1nc2c(s1)CCCC2.S |
| InChI | InChI=1S/C10H12N2S.H2S/c1-2-11-7-10-12-8-5-3-4-6-9(8)13-10;/h2,7H,1,3-6H2;1H2/b11-7+; |
| InChIKey | UZRSQSZAOQUBBU-RVDQCCQOSA-N |
| XLogP | 2.70 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|