C8H11KNO2PS — CID 23722120
potassium methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphinate (PubChem CID 23722120) has the molecular formula C8H11KNO2PS and a molecular weight of 255.32 g/mol. Its IUPAC name is potassium methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphinate.
| Compound Name | potassium methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphinate |
|---|---|
| PubChem CID | 23722120 |
| Molecular Formula | C8H11KNO2PS |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | potassium methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphinate |
| SMILES | CP(=O)([O-])c1nc2c(s1)CCCC2.[K+] |
| InChI | InChI=1S/C8H12NO2PS.K/c1-12(10,11)8-9-6-4-2-3-5-7(6)13-8;/h2-5H2,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | NWRGNIQIQFJGQK-UHFFFAOYSA-M |
| XLogP | -2.08 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|