C13H16N3OPS — CID 27331649
N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]pyridin-2-amine (PubChem CID 27331649) has the molecular formula C13H16N3OPS and a molecular weight of 293.33 g/mol. Its IUPAC name is N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]pyridin-2-amine.
| Compound Name | N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]pyridin-2-amine |
|---|---|
| PubChem CID | 27331649 |
| Molecular Formula | C13H16N3OPS |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]pyridin-2-amine |
| SMILES | C[P@@](=O)(Nc1ccccn1)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C13H16N3OPS/c1-18(17,16-12-8-4-5-9-14-12)13-15-10-6-2-3-7-11(10)19-13/h4-5,8-9H,2-3,6-7H2,1H3,(H,14,16,17)/t18-/m0/s1 |
| InChIKey | VWMKTRRALUBMBL-SFHVURJKSA-N |
| XLogP | 3.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|