C18H19N2OPS — CID 11864598
N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]naphthalen-2-amine (PubChem CID 11864598) has the molecular formula C18H19N2OPS and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]naphthalen-2-amine.
| Compound Name | N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]naphthalen-2-amine |
|---|---|
| PubChem CID | 11864598 |
| Molecular Formula | C18H19N2OPS |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]naphthalen-2-amine |
| SMILES | C[P@@](=O)(Nc1ccc2ccccc2c1)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C18H19N2OPS/c1-22(21,18-19-16-8-4-5-9-17(16)23-18)20-15-11-10-13-6-2-3-7-14(13)12-15/h2-3,6-7,10-12H,4-5,8-9H2,1H3,(H,20,21)/t22-/m0/s1 |
| InChIKey | DFEFULSXKSEAIM-QFIPXVFZSA-N |
| XLogP | 4.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|