C14H16N3O3PS — CID 11864683
N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]-3-nitroaniline (PubChem CID 11864683) has the molecular formula C14H16N3O3PS and a molecular weight of 337.34 g/mol. Its IUPAC name is N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]-3-nitroaniline.
| Compound Name | N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]-3-nitroaniline |
|---|---|
| PubChem CID | 11864683 |
| Molecular Formula | C14H16N3O3PS |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]-3-nitroaniline |
| SMILES | C[P@](=O)(Nc1cccc([N+](=O)[O-])c1)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H16N3O3PS/c1-21(20,14-15-12-7-2-3-8-13(12)22-14)16-10-5-4-6-11(9-10)17(18)19/h4-6,9H,2-3,7-8H2,1H3,(H,16,20)/t21-/m1/s1 |
| InChIKey | LHPVJFKFEOASAG-OAQYLSRUSA-N |
| XLogP | 3.58 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|