C15H19N2OPS — CID 2312046
4-methyl-N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline (PubChem CID 2312046) has the molecular formula C15H19N2OPS and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-methyl-N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline.
| Compound Name | 4-methyl-N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline |
|---|---|
| PubChem CID | 2312046 |
| Molecular Formula | C15H19N2OPS |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-methyl-N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline |
| SMILES | Cc1ccc(NP(C)(=O)c2nc3c(s2)CCCC3)cc1 |
| InChI | InChI=1S/C15H19N2OPS/c1-11-7-9-12(10-8-11)17-19(2,18)15-16-13-5-3-4-6-14(13)20-15/h7-10H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | QDNCSFTXOWZNGX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|