C14H16IN2OPS — CID 2312759
4-iodo-N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline (PubChem CID 2312759) has the molecular formula C14H16IN2OPS and a molecular weight of 418.24 g/mol. Its IUPAC name is 4-iodo-N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline.
| Compound Name | 4-iodo-N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline |
|---|---|
| PubChem CID | 2312759 |
| Molecular Formula | C14H16IN2OPS |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 4-iodo-N-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline |
| SMILES | CP(=O)(Nc1ccc(I)cc1)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H16IN2OPS/c1-19(18,17-11-8-6-10(15)7-9-11)14-16-12-4-2-3-5-13(12)20-14/h6-9H,2-5H2,1H3,(H,17,18) |
| InChIKey | WAQOUGANHYXRTR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|