C15H17IN2S — CID 90864127
2-iodo-N,N-dimethyl-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)aniline (PubChem CID 90864127) has the molecular formula C15H17IN2S and a molecular weight of 384.29 g/mol. Its IUPAC name is 2-iodo-N,N-dimethyl-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)aniline.
| Compound Name | 2-iodo-N,N-dimethyl-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)aniline |
|---|---|
| PubChem CID | 90864127 |
| Molecular Formula | C15H17IN2S |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2-iodo-N,N-dimethyl-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)aniline |
| SMILES | CN(C)c1ccc(-c2nc3c(s2)CCCC3)cc1I |
| InChI | InChI=1S/C15H17IN2S/c1-18(2)13-8-7-10(9-11(13)16)15-17-12-5-3-4-6-14(12)19-15/h7-9H,3-6H2,1-2H3 |
| InChIKey | PSWMXCGZQXOPDM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|