C12H12N2S — CID 14531647
2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 14531647) has the molecular formula C12H12N2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole.
| Compound Name | 2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 14531647 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole |
| SMILES | c1cc(-c2nc3c(s2)CCCC3)ccn1 |
| InChI | InChI=1S/C12H12N2S/c1-2-4-11-10(3-1)14-12(15-11)9-5-7-13-8-6-9/h5-8H,1-4H2 |
| InChIKey | KNIVWOXUEPAEQW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |