C26H29N3O5 — CID 4585046
2-methyl-N-(5-methyl-2-pyridinyl)-5-oxo-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 4585046) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-methyl-N-(5-methyl-2-pyridinyl)-5-oxo-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | 2-methyl-N-(5-methyl-2-pyridinyl)-5-oxo-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 4585046 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 2-methyl-N-(5-methyl-2-pyridinyl)-5-oxo-4-(2,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | COc1cc(OC)c(C2C(C(=O)Nc3ccc(C)cn3)=C(C)NC3=C2C(=O)CCC3)cc1OC |
| InChI | InChI=1S/C26H29N3O5/c1-14-9-10-22(27-13-14)29-26(31)23-15(2)28-17-7-6-8-18(30)25(17)24(23)16-11-20(33-4)21(34-5)12-19(16)32-3/h9-13,24,28H,6-8H2,1-5H3,(H,27,29,31) |
| InChIKey | WCDIVRIAFSSDPO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |