C19H22N4O3 — CID 4585260
N-[[4-[2-(4-methoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]pyridine-4-carboxamide (PubChem CID 4585260) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[[4-[2-(4-methoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[[4-[2-(4-methoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 4585260 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[[4-[2-(4-methoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]pyridine-4-carboxamide |
| SMILES | COc1ccc(CCNC(=O)CC(C)=NNC(=O)c2ccncc2)cc1 |
| InChI | InChI=1S/C19H22N4O3/c1-14(22-23-19(25)16-8-10-20-11-9-16)13-18(24)21-12-7-15-3-5-17(26-2)6-4-15/h3-6,8-11H,7,12-13H2,1-2H3,(H,21,24)(H,23,25) |
| InChIKey | LXKKQWZDOQVNEH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|