C23H27ClN4O6 — CID 4203158
N-(4-chloro-2,5-dimethoxyphenyl)-N'-[[4-[2-(4-methoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]oxamide (PubChem CID 4203158) has the molecular formula C23H27ClN4O6 and a molecular weight of 490.94 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-N'-[[4-[2-(4-methoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]oxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-N'-[[4-[2-(4-methoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]oxamide |
|---|---|
| PubChem CID | 4203158 |
| Molecular Formula | C23H27ClN4O6 |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-N'-[[4-[2-(4-methoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]oxamide |
| SMILES | COc1ccc(CCNC(=O)CC(C)=NNC(=O)C(=O)Nc2cc(OC)c(Cl)cc2OC)cc1 |
| InChI | InChI=1S/C23H27ClN4O6/c1-14(11-21(29)25-10-9-15-5-7-16(32-2)8-6-15)27-28-23(31)22(30)26-18-13-19(33-3)17(24)12-20(18)34-4/h5-8,12-13H,9-11H2,1-4H3,(H,25,29)(H,26,30)(H,28,31) |
| InChIKey | MTFAZVUJWIWGLU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|