C18H23ClN4O6 — CID 45034145
(3E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[(2-morpholin-4-yl-2-oxoacetyl)hydrazinylidene]butanamide (PubChem CID 45034145) has the molecular formula C18H23ClN4O6 and a molecular weight of 426.86 g/mol. Its IUPAC name is (3E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[(2-morpholin-4-yl-2-oxoacetyl)hydrazinylidene]butanamide.
| Compound Name | (3E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[(2-morpholin-4-yl-2-oxoacetyl)hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 45034145 |
| Molecular Formula | C18H23ClN4O6 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (3E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-[(2-morpholin-4-yl-2-oxoacetyl)hydrazinylidene]butanamide |
| SMILES | COc1cc(NC(=O)C/C(C)=N/NC(=O)C(=O)N2CCOCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C18H23ClN4O6/c1-11(21-22-17(25)18(26)23-4-6-29-7-5-23)8-16(24)20-13-10-14(27-2)12(19)9-15(13)28-3/h9-10H,4-8H2,1-3H3,(H,20,24)(H,22,25)/b21-11+ |
| InChIKey | GLRAJEOXZKJHRX-SRZZPIQSSA-N |
| XLogP | 1.04 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|