C17H18ClN3O5 — CID 4216344
N-[[4-(5-chloro-2,4-dimethoxyanilino)-4-oxobutan-2-ylidene]amino]furan-2-carboxamide (PubChem CID 4216344) has the molecular formula C17H18ClN3O5 and a molecular weight of 379.80 g/mol. Its IUPAC name is N-[[4-(5-chloro-2,4-dimethoxyanilino)-4-oxobutan-2-ylidene]amino]furan-2-carboxamide.
| Compound Name | N-[[4-(5-chloro-2,4-dimethoxyanilino)-4-oxobutan-2-ylidene]amino]furan-2-carboxamide |
|---|---|
| PubChem CID | 4216344 |
| Molecular Formula | C17H18ClN3O5 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[[4-(5-chloro-2,4-dimethoxyanilino)-4-oxobutan-2-ylidene]amino]furan-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)CC(C)=NNC(=O)c2ccco2)cc1Cl |
| InChI | InChI=1S/C17H18ClN3O5/c1-10(20-21-17(23)13-5-4-6-26-13)7-16(22)19-12-8-11(18)14(24-2)9-15(12)25-3/h4-6,8-9H,7H2,1-3H3,(H,19,22)(H,21,23) |
| InChIKey | ZRIDHXPOEIBOQK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|