C12H9F2NO3 — CID 4587029
ethyl 5,7-difluoro-3-formyl-1H-indole-2-carboxylate (PubChem CID 4587029) has the molecular formula C12H9F2NO3 and a molecular weight of 253.20 g/mol. Its IUPAC name is ethyl 5,7-difluoro-3-formyl-1H-indole-2-carboxylate.
| Compound Name | ethyl 5,7-difluoro-3-formyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 4587029 |
| Molecular Formula | C12H9F2NO3 |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | ethyl 5,7-difluoro-3-formyl-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(F)cc(F)cc2c1C=O |
| InChI | InChI=1S/C12H9F2NO3/c1-2-18-12(17)11-8(5-16)7-3-6(13)4-9(14)10(7)15-11/h3-5,15H,2H2,1H3 |
| InChIKey | QUIDYGCZHWXPCZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|