C19H13F12N3O3 — CID 4588483
ethyl 5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoylamino)-1-phenylpyrazole-4-carboxylate (PubChem CID 4588483) has the molecular formula C19H13F12N3O3 and a molecular weight of 559.31 g/mol. Its IUPAC name is ethyl 5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoylamino)-1-phenylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoylamino)-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 4588483 |
| Molecular Formula | C19H13F12N3O3 |
| Molecular Weight | 559.31 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | ethyl 5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoylamino)-1-phenylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C19H13F12N3O3/c1-2-37-12(35)10-8-32-34(9-6-4-3-5-7-9)11(10)33-14(36)16(24,25)18(28,29)19(30,31)17(26,27)15(22,23)13(20)21/h3-8,13H,2H2,1H3,(H,33,36) |
| InChIKey | RUFHJPNHLMSNBH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.31 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|