C20H21N3O3S2 — CID 4589338
4-(2-methylpropylsulfanyl)-6-nitro-3-(1,3-oxathiolan-2-yl)-1-phenylindazole (PubChem CID 4589338) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-(2-methylpropylsulfanyl)-6-nitro-3-(1,3-oxathiolan-2-yl)-1-phenylindazole.
| Compound Name | 4-(2-methylpropylsulfanyl)-6-nitro-3-(1,3-oxathiolan-2-yl)-1-phenylindazole |
|---|---|
| PubChem CID | 4589338 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 4-(2-methylpropylsulfanyl)-6-nitro-3-(1,3-oxathiolan-2-yl)-1-phenylindazole |
| SMILES | CC(C)CSc1cc([N+](=O)[O-])cc2c1c(C1OCCS1)nn2-c1ccccc1 |
| InChI | InChI=1S/C20H21N3O3S2/c1-13(2)12-28-17-11-15(23(24)25)10-16-18(17)19(20-26-8-9-27-20)21-22(16)14-6-4-3-5-7-14/h3-7,10-11,13,20H,8-9,12H2,1-2H3 |
| InChIKey | XZLUTCOCFALZAS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|