C21H24N4O3SSi — CID 156744542
4-benzylsulfanyl-6-nitro-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonitrile (PubChem CID 156744542) has the molecular formula C21H24N4O3SSi and a molecular weight of 440.60 g/mol. Its IUPAC name is 4-benzylsulfanyl-6-nitro-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonitrile.
| Compound Name | 4-benzylsulfanyl-6-nitro-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonitrile |
|---|---|
| PubChem CID | 156744542 |
| Molecular Formula | C21H24N4O3SSi |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 4-benzylsulfanyl-6-nitro-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1c(C#N)nc2c(SCc3ccccc3)cc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C21H24N4O3SSi/c1-30(2,3)10-9-28-15-24-18-11-17(25(26)27)12-19(21(18)23-20(24)13-22)29-14-16-7-5-4-6-8-16/h4-8,11-12H,9-10,14-15H2,1-3H3 |
| InChIKey | DQWKOIOKWQDWBM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 93.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|