C18H25N5O5 — CID 4591216
4-methyl-N-[[4-(2-morpholin-4-ylethylamino)-4-oxobutan-2-ylidene]amino]-3-nitrobenzamide (PubChem CID 4591216) has the molecular formula C18H25N5O5 and a molecular weight of 391.43 g/mol. Its IUPAC name is 4-methyl-N-[[4-(2-morpholin-4-ylethylamino)-4-oxobutan-2-ylidene]amino]-3-nitrobenzamide.
| Compound Name | 4-methyl-N-[[4-(2-morpholin-4-ylethylamino)-4-oxobutan-2-ylidene]amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4591216 |
| Molecular Formula | C18H25N5O5 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 4-methyl-N-[[4-(2-morpholin-4-ylethylamino)-4-oxobutan-2-ylidene]amino]-3-nitrobenzamide |
| SMILES | CC(CC(=O)NCCN1CCOCC1)=NNC(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H25N5O5/c1-13-3-4-15(12-16(13)23(26)27)18(25)21-20-14(2)11-17(24)19-5-6-22-7-9-28-10-8-22/h3-4,12H,5-11H2,1-2H3,(H,19,24)(H,21,25) |
| InChIKey | MVOFDSQBRQVTOY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|