C39H52N4O10 — CID 4597829
diethyl 1-[15,16-bis(4-hydroxybutyl)-12-methoxyimino-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate (PubChem CID 4597829) has the molecular formula C39H52N4O10 and a molecular weight of 736.86 g/mol. Its IUPAC name is diethyl 1-[15,16-bis(4-hydroxybutyl)-12-methoxyimino-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate.
| Compound Name | diethyl 1-[15,16-bis(4-hydroxybutyl)-12-methoxyimino-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 4597829 |
| Molecular Formula | C39H52N4O10 |
| Molecular Weight | 736.86 g/mol |
| Exact Mass | 736.37 |
| IUPAC Name | diethyl 1-[15,16-bis(4-hydroxybutyl)-12-methoxyimino-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate |
| SMILES | C=CCOc1ccc2c(c1)C1C(CCCCO)C(CCCCO)C=C3C(=NOC)CC(n4nnc(C(=O)OCC)c4C(=O)OCC)C(OCC=C)(O2)C31 |
| InChI | InChI=1S/C39H52N4O10/c1-6-20-51-26-16-17-31-29(23-26)33-27(15-11-13-19-45)25(14-10-12-18-44)22-28-30(41-48-5)24-32(39(53-31,34(28)33)52-21-7-2)43-36(38(47)50-9-4)35(40-42-43)37(46)49-8-3/h6-7,16-17,22-23,25,27,32-34,44-45H,1-2,8-15,18-21,24H2,3-5H3 |
| InChIKey | NNCGTUWCAGBEDK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 173.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.86 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|