C38H52N4O8 — CID 5221614
tert-butyl 3-[15,16-bis(4-hydroxybutyl)-12-methoxyimino-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylate (PubChem CID 5221614) has the molecular formula C38H52N4O8 and a molecular weight of 692.85 g/mol. Its IUPAC name is tert-butyl 3-[15,16-bis(4-hydroxybutyl)-12-methoxyimino-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylate.
| Compound Name | tert-butyl 3-[15,16-bis(4-hydroxybutyl)-12-methoxyimino-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 5221614 |
| Molecular Formula | C38H52N4O8 |
| Molecular Weight | 692.85 g/mol |
| Exact Mass | 692.38 |
| IUPAC Name | tert-butyl 3-[15,16-bis(4-hydroxybutyl)-12-methoxyimino-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylate |
| SMILES | C=CCOc1ccc2c(c1)C1C(CCCCO)C(CCCCO)C=C3C(=NOC)CC(n4nncc4C(=O)OC(C)(C)C)C(OCC=C)(O2)C31 |
| InChI | InChI=1S/C38H52N4O8/c1-7-19-47-26-15-16-32-29(22-26)34-27(14-10-12-18-44)25(13-9-11-17-43)21-28-30(40-46-6)23-33(38(49-32,35(28)34)48-20-8-2)42-31(24-39-41-42)36(45)50-37(3,4)5/h7-8,15-16,21-22,24-25,27,33-35,43-44H,1-2,9-14,17-20,23H2,3-6H3 |
| InChIKey | QAEPLBPGFIKDNA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 146.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.85 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|