C23H17Cl2N3O7 — CID 4598140
[2-methoxy-4-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 4598140) has the molecular formula C23H17Cl2N3O7 and a molecular weight of 518.31 g/mol. Its IUPAC name is [2-methoxy-4-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-methoxy-4-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4598140 |
| Molecular Formula | C23H17Cl2N3O7 |
| Molecular Weight | 518.31 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | [2-methoxy-4-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)COc2ccccc2[N+](=O)[O-])ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H17Cl2N3O7/c1-33-21-10-14(6-9-20(21)35-23(30)16-8-7-15(24)11-17(16)25)12-26-27-22(29)13-34-19-5-3-2-4-18(19)28(31)32/h2-12H,13H2,1H3,(H,27,29) |
| InChIKey | AQVZVHSXDRPESQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|