C17H28ClN3O2S — CID 4600664
2-[[4-chlorobutanoyl(2-methylpropyl)amino]methyl]-N-(2-methylpropyl)-1,3-thiazole-4-carboxamide (PubChem CID 4600664) has the molecular formula C17H28ClN3O2S and a molecular weight of 373.95 g/mol. Its IUPAC name is 2-[[4-chlorobutanoyl(2-methylpropyl)amino]methyl]-N-(2-methylpropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[4-chlorobutanoyl(2-methylpropyl)amino]methyl]-N-(2-methylpropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4600664 |
| Molecular Formula | C17H28ClN3O2S |
| Molecular Weight | 373.95 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[[4-chlorobutanoyl(2-methylpropyl)amino]methyl]-N-(2-methylpropyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)CNC(=O)c1csc(CN(CC(C)C)C(=O)CCCCl)n1 |
| InChI | InChI=1S/C17H28ClN3O2S/c1-12(2)8-19-17(23)14-11-24-15(20-14)10-21(9-13(3)4)16(22)6-5-7-18/h11-13H,5-10H2,1-4H3,(H,19,23) |
| InChIKey | RLOPUTIHQDHIEM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.95 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|