C24H27NO2 — CID 46006776
2-[(4-methoxyphenyl)methyl-[(3-methylphenyl)methyl]amino]-1-phenylethanol (PubChem CID 46006776) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl-[(3-methylphenyl)methyl]amino]-1-phenylethanol.
| Compound Name | 2-[(4-methoxyphenyl)methyl-[(3-methylphenyl)methyl]amino]-1-phenylethanol |
|---|---|
| PubChem CID | 46006776 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl-[(3-methylphenyl)methyl]amino]-1-phenylethanol |
| SMILES | COc1ccc(CN(Cc2cccc(C)c2)CC(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H27NO2/c1-19-7-6-8-21(15-19)17-25(16-20-11-13-23(27-2)14-12-20)18-24(26)22-9-4-3-5-10-22/h3-15,24,26H,16-18H2,1-2H3 |
| InChIKey | MNSVVPZZEMTHDF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |