C27H24ClN3O3 — CID 46013907
[4-[4-[(4-chlorobenzoyl)amino]phenyl]-3-ethyl-1-(4-methylphenyl)pyrazol-5-yl] acetate (PubChem CID 46013907) has the molecular formula C27H24ClN3O3 and a molecular weight of 473.96 g/mol. Its IUPAC name is [4-[4-[(4-chlorobenzoyl)amino]phenyl]-3-ethyl-1-(4-methylphenyl)pyrazol-5-yl] acetate.
| Compound Name | [4-[4-[(4-chlorobenzoyl)amino]phenyl]-3-ethyl-1-(4-methylphenyl)pyrazol-5-yl] acetate |
|---|---|
| PubChem CID | 46013907 |
| Molecular Formula | C27H24ClN3O3 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | [4-[4-[(4-chlorobenzoyl)amino]phenyl]-3-ethyl-1-(4-methylphenyl)pyrazol-5-yl] acetate |
| SMILES | CCc1nn(-c2ccc(C)cc2)c(OC(C)=O)c1-c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H24ClN3O3/c1-4-24-25(27(34-18(3)32)31(30-24)23-15-5-17(2)6-16-23)19-9-13-22(14-10-19)29-26(33)20-7-11-21(28)12-8-20/h5-16H,4H2,1-3H3,(H,29,33) |
| InChIKey | SCHDLYZWBYNDQC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |