C27H36N4O3S — CID 46015682
11-benzyl-5-[[[2-hydroxy-3-(2-methylpropoxy)propyl]-prop-2-enylamino]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 46015682) has the molecular formula C27H36N4O3S and a molecular weight of 496.68 g/mol. Its IUPAC name is 11-benzyl-5-[[[2-hydroxy-3-(2-methylpropoxy)propyl]-prop-2-enylamino]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 11-benzyl-5-[[[2-hydroxy-3-(2-methylpropoxy)propyl]-prop-2-enylamino]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 46015682 |
| Molecular Formula | C27H36N4O3S |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 11-benzyl-5-[[[2-hydroxy-3-(2-methylpropoxy)propyl]-prop-2-enylamino]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | C=CCN(Cc1nc2sc3c(c2c(=O)[nH]1)CCN(Cc1ccccc1)C3)CC(O)COCC(C)C |
| InChI | InChI=1S/C27H36N4O3S/c1-4-11-30(14-21(32)18-34-17-19(2)3)16-24-28-26(33)25-22-10-12-31(13-20-8-6-5-7-9-20)15-23(22)35-27(25)29-24/h4-9,19,21,32H,1,10-18H2,2-3H3,(H,28,29,33) |
| InChIKey | FQEWINQSBFCUCY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|