C24H32N4O4S — CID 46015697
11-benzyl-5-[[(2-hydroxy-3-methoxypropyl)-(2-methoxyethyl)amino]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 46015697) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is 11-benzyl-5-[[(2-hydroxy-3-methoxypropyl)-(2-methoxyethyl)amino]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 11-benzyl-5-[[(2-hydroxy-3-methoxypropyl)-(2-methoxyethyl)amino]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 46015697 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 11-benzyl-5-[[(2-hydroxy-3-methoxypropyl)-(2-methoxyethyl)amino]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | COCCN(Cc1nc2sc3c(c2c(=O)[nH]1)CCN(Cc1ccccc1)C3)CC(O)COC |
| InChI | InChI=1S/C24H32N4O4S/c1-31-11-10-28(13-18(29)16-32-2)15-21-25-23(30)22-19-8-9-27(12-17-6-4-3-5-7-17)14-20(19)33-24(22)26-21/h3-7,18,29H,8-16H2,1-2H3,(H,25,26,30) |
| InChIKey | ZGFITNVCHLJSBF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |