C23H29N3O6S — CID 46018664
propan-2-yl 2-[[furan-2-ylmethyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 46018664) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is propan-2-yl 2-[[furan-2-ylmethyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl 2-[[furan-2-ylmethyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 46018664 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | propan-2-yl 2-[[furan-2-ylmethyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | C=CCOCC(O)CN(Cc1nc2sc(C(=O)OC(C)C)c(C)c2c(=O)[nH]1)Cc1ccco1 |
| InChI | InChI=1S/C23H29N3O6S/c1-5-8-30-13-16(27)10-26(11-17-7-6-9-31-17)12-18-24-21(28)19-15(4)20(33-22(19)25-18)23(29)32-14(2)3/h5-7,9,14,16,27H,1,8,10-13H2,2-4H3,(H,24,25,28) |
| InChIKey | PXOIUWCZNAHIPX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|