C21H31N3O6S — CID 93195770
ethyl 2-[[[(2R)-2-hydroxy-3-prop-2-enoxypropyl]-(3-methoxypropyl)amino]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 93195770) has the molecular formula C21H31N3O6S and a molecular weight of 453.56 g/mol. Its IUPAC name is ethyl 2-[[[(2R)-2-hydroxy-3-prop-2-enoxypropyl]-(3-methoxypropyl)amino]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-[[[(2R)-2-hydroxy-3-prop-2-enoxypropyl]-(3-methoxypropyl)amino]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 93195770 |
| Molecular Formula | C21H31N3O6S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | ethyl 2-[[[(2R)-2-hydroxy-3-prop-2-enoxypropyl]-(3-methoxypropyl)amino]methyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | C=CCOC[C@H](O)CN(CCCOC)Cc1nc2sc(C(=O)OCC)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C21H31N3O6S/c1-5-9-29-13-15(25)11-24(8-7-10-28-4)12-16-22-19(26)17-14(3)18(21(27)30-6-2)31-20(17)23-16/h5,15,25H,1,6-13H2,2-4H3,(H,22,23,26)/t15-/m1/s1 |
| InChIKey | IIFJUUMMRLCEHT-OAHLLOKOSA-N |
| XLogP | 1.87 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|